C30H31FN4O4 — CID 131739632
[3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] benzoate (PubChem CID 131739632) has the molecular formula C30H31FN4O4 and a molecular weight of 530.60 g/mol. Its IUPAC name is [3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] benzoate.
| Compound Name | [3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] benzoate |
|---|---|
| PubChem CID | 131739632 |
| Molecular Formula | C30H31FN4O4 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | [3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl] benzoate |
| SMILES | Cc1nc2n(c(=O)c1CCN1CCC(c3noc4cc(F)ccc34)CC1)CCCC2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H31FN4O4/c1-19-23(13-17-34-15-11-20(12-16-34)27-24-10-9-22(31)18-26(24)39-33-27)29(36)35-14-5-8-25(28(35)32-19)38-30(37)21-6-3-2-4-7-21/h2-4,6-7,9-10,18,20,25H,5,8,11-17H2,1H3 |
| InChIKey | CVALSGCNMSZXIY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 90.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |