C33H45FN6O4 — CID 86711159
3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-9-(6-oxo-6-piperazin-1-ylhexoxy)-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 86711159) has the molecular formula C33H45FN6O4 and a molecular weight of 608.76 g/mol. Its IUPAC name is 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-9-(6-oxo-6-piperazin-1-ylhexoxy)-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-9-(6-oxo-6-piperazin-1-ylhexoxy)-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 86711159 |
| Molecular Formula | C33H45FN6O4 |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-9-(6-oxo-6-piperazin-1-ylhexoxy)-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1nc2n(c(=O)c1CCN1CCC(c3noc4cc(F)ccc34)CC1)CCCC2OCCCCCC(=O)N1CCNCC1 |
| InChI | InChI=1S/C33H45FN6O4/c1-23-26(12-18-38-16-10-24(11-17-38)31-27-9-8-25(34)22-29(27)44-37-31)33(42)40-15-5-6-28(32(40)36-23)43-21-4-2-3-7-30(41)39-19-13-35-14-20-39/h8-9,22,24,28,35H,2-7,10-21H2,1H3 |
| InChIKey | BDKNAFNPJDKKNK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|