C26H31FN4O5 — CID 53308048
[3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl]oxymethyl acetate (PubChem CID 53308048) has the molecular formula C26H31FN4O5 and a molecular weight of 498.56 g/mol. Its IUPAC name is [3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl]oxymethyl acetate.
| Compound Name | [3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl]oxymethyl acetate |
|---|---|
| PubChem CID | 53308048 |
| Molecular Formula | C26H31FN4O5 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | [3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl]oxymethyl acetate |
| SMILES | CC(=O)OCOC1CCCn2c1nc(C)c(CCN1CCC(c3noc4cc(F)ccc34)CC1)c2=O |
| InChI | InChI=1S/C26H31FN4O5/c1-16-20(26(33)31-10-3-4-22(25(31)28-16)35-15-34-17(2)32)9-13-30-11-7-18(8-12-30)24-21-6-5-19(27)14-23(21)36-29-24/h5-6,14,18,22H,3-4,7-13,15H2,1-2H3 |
| InChIKey | SZJFTQFIRNCUTR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 99.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|