C32H46FN5O5 — CID 159137448
carbanide;[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl N-(4-methylpentyl)carbamate (PubChem CID 159137448) has the molecular formula C32H46FN5O5 and a molecular weight of 599.75 g/mol. Its IUPAC name is carbanide;[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl N-(4-methylpentyl)carbamate.
| Compound Name | carbanide;[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl N-(4-methylpentyl)carbamate |
|---|---|
| PubChem CID | 159137448 |
| Molecular Formula | C32H46FN5O5 |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | carbanide;[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl N-(4-methylpentyl)carbamate |
| SMILES | Cc1nc2n(c(=O)c1CC[N+]1(COC(=O)NCCCC(C)C)CCC(c3noc4cc(F)ccc34)CC1)CCCC2O.[CH3-] |
| InChI | InChI=1S/C31H42FN5O5.CH3/c1-20(2)6-4-13-33-31(40)41-19-37(17-12-24-21(3)34-29-26(38)7-5-14-36(29)30(24)39)15-10-22(11-16-37)28-25-9-8-23(32)18-27(25)42-35-28;/h8-9,18,20,22,26,38H,4-7,10-17,19H2,1-3H3;1H3/q;-1/p+1 |
| InChIKey | AIJPEWSYDBQECW-UHFFFAOYSA-O |
| XLogP | 5.17 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|