C30H38FN4O6+ — CID 58337305
[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl [(Z)-pent-2-enyl] carbonate (PubChem CID 58337305) has the molecular formula C30H38FN4O6+ and a molecular weight of 569.65 g/mol. Its IUPAC name is [4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl [(Z)-pent-2-enyl] carbonate.
| Compound Name | [4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl [(Z)-pent-2-enyl] carbonate |
|---|---|
| PubChem CID | 58337305 |
| Molecular Formula | C30H38FN4O6+ |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | [4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl [(Z)-pent-2-enyl] carbonate |
| SMILES | CC/C=C\COC(=O)OC[N+]1(CCc2c(C)nc3n(c2=O)CCCC3O)CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C30H38FN4O6/c1-3-4-5-17-39-30(38)40-19-35(16-12-23-20(2)32-28-25(36)7-6-13-34(28)29(23)37)14-10-21(11-15-35)27-24-9-8-22(31)18-26(24)41-33-27/h4-5,8-9,18,21,25,36H,3,6-7,10-17,19H2,1-2H3/q+1/b5-4- |
| InChIKey | XILKPBGUUSAYCO-PLNGDYQASA-N |
| XLogP | 4.67 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|