About [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate
[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate (PubChem CID 67591930) has the molecular formula C17H22FN3O3
and a molecular weight of 335.38 g/mol. Its IUPAC name is [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate.
Molecular Properties
| Compound Name | [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate |
| PubChem CID | 67591930 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate |
| SMILES | CCCCNC(=O)ON1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C17H22FN3O3/c1-2-3-8-19-17(22)24-21-9-6-12(7-10-21)16-14-5-4-13(18)11-15(14)23-20-16/h4-5,11-12H,2-3,6-10H2,1H3,(H,19,22) |
| InChIKey | QQTQRPWSLBNAMH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate?
The IUPAC name of [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate (CID 67591930) is [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate.
What is the SMILES notation for [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate?
The canonical SMILES for [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate is CCCCNC(=O)ON1CCC(c2noc3cc(F)ccc23)CC1.
What is the InChIKey of [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate?
The InChIKey is QQTQRPWSLBNAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22FN3O3/c1-2-3-8-19-17(22)24-21-9-6-12(7-10-21)16-14-5-4-13(18)11-15(14)23-20-16/h4-5,11-12H,2-3,6-10H2,1H3,(H,19,22).
What are the key properties of [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate?
[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate has a molecular weight of 335.38 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] N-butylcarbamate is sourced from PubChem (CID 67591930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).