C17H26Cl2FN3O — CID 156540523
N-ethyl-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propan-1-amine;dihydrochloride (PubChem CID 156540523) has the molecular formula C17H26Cl2FN3O and a molecular weight of 378.32 g/mol. Its IUPAC name is N-ethyl-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propan-1-amine;dihydrochloride.
| Compound Name | N-ethyl-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 156540523 |
| Molecular Formula | C17H26Cl2FN3O |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-ethyl-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propan-1-amine;dihydrochloride |
| SMILES | CCNCCCN1CCC(c2noc3cc(F)ccc23)CC1.Cl.Cl |
| InChI | InChI=1S/C17H24FN3O.2ClH/c1-2-19-8-3-9-21-10-6-13(7-11-21)17-15-5-4-14(18)12-16(15)22-20-17;;/h4-5,12-13,19H,2-3,6-11H2,1H3;2*1H |
| InChIKey | QLNRWNJALHGEJZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|