C22H27FN2O7 — CID 67559128
but-2-enedioic acid;[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] hexanoate (PubChem CID 67559128) has the molecular formula C22H27FN2O7 and a molecular weight of 450.46 g/mol. Its IUPAC name is but-2-enedioic acid;[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] hexanoate.
| Compound Name | but-2-enedioic acid;[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] hexanoate |
|---|---|
| PubChem CID | 67559128 |
| Molecular Formula | C22H27FN2O7 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | but-2-enedioic acid;[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl] hexanoate |
| SMILES | CCCCCC(=O)ON1CCC(c2noc3cc(F)ccc23)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H23FN2O3.C4H4O4/c1-2-3-4-5-17(22)24-21-10-8-13(9-11-21)18-15-7-6-14(19)12-16(15)23-20-18;5-3(6)1-2-4(7)8/h6-7,12-13H,2-5,8-11H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | JZAOTSIKRWFAQX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|