C22H27FN2O8 — CID 22867481
(E)-but-2-enedioic acid;[(2R)-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-methylpropyl] ethaneperoxoate (PubChem CID 22867481) has the molecular formula C22H27FN2O8 and a molecular weight of 466.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;[(2R)-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-methylpropyl] ethaneperoxoate.
| Compound Name | (E)-but-2-enedioic acid;[(2R)-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-methylpropyl] ethaneperoxoate |
|---|---|
| PubChem CID | 22867481 |
| Molecular Formula | C22H27FN2O8 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | (E)-but-2-enedioic acid;[(2R)-3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-methylpropyl] ethaneperoxoate |
| SMILES | CC(=O)OOC[C@H](C)CN1CCC(c2noc3cc(F)ccc23)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H23FN2O4.C4H4O4/c1-12(11-23-25-13(2)22)10-21-7-5-14(6-8-21)18-16-4-3-15(19)9-17(16)24-20-18;5-3(6)1-2-4(7)8/h3-4,9,12,14H,5-8,10-11H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t12-;/m1./s1 |
| InChIKey | IGVBVLHPZKEMJQ-SNXORLAUSA-N |
| XLogP | 2.99 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|