C21H23FN2O3 — CID 140972247
1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-3-phenoxypropan-2-ol (PubChem CID 140972247) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-3-phenoxypropan-2-ol.
| Compound Name | 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 140972247 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-3-phenoxypropan-2-ol |
| SMILES | OC(COc1ccccc1)CN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C21H23FN2O3/c22-16-6-7-19-20(12-16)27-23-21(19)15-8-10-24(11-9-15)13-17(25)14-26-18-4-2-1-3-5-18/h1-7,12,15,17,25H,8-11,13-14H2 |
| InChIKey | DUSZWGGFFGHGAD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |