C37H44FN3O9 — CID 67070974
but-2-enedioic acid;2-[3-(1,3-dioxoisoindol-2-yl)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]decanoic acid (PubChem CID 67070974) has the molecular formula C37H44FN3O9 and a molecular weight of 693.77 g/mol. Its IUPAC name is but-2-enedioic acid;2-[3-(1,3-dioxoisoindol-2-yl)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]decanoic acid.
| Compound Name | but-2-enedioic acid;2-[3-(1,3-dioxoisoindol-2-yl)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]decanoic acid |
|---|---|
| PubChem CID | 67070974 |
| Molecular Formula | C37H44FN3O9 |
| Molecular Weight | 693.77 g/mol |
| Exact Mass | 693.31 |
| IUPAC Name | but-2-enedioic acid;2-[3-(1,3-dioxoisoindol-2-yl)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl]decanoic acid |
| SMILES | CCCCCCCCC(C(=O)O)C(CCN1C(=O)c2ccccc2C1=O)N1CCC(c2noc3cc(F)ccc23)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C33H40FN3O5.C4H4O4/c1-2-3-4-5-6-7-12-26(33(40)41)28(17-20-37-31(38)24-10-8-9-11-25(24)32(37)39)36-18-15-22(16-19-36)30-27-14-13-23(34)21-29(27)42-35-30;5-3(6)1-2-4(7)8/h8-11,13-14,21-22,26,28H,2-7,12,15-20H2,1H3,(H,40,41);1-2H,(H,5,6)(H,7,8) |
| InChIKey | GTUOBEGSWASGOV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 178.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.77 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|