C30H24FN5O3 — CID 139959494
2-[[3-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]quinoxalin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 139959494) has the molecular formula C30H24FN5O3 and a molecular weight of 521.55 g/mol. Its IUPAC name is 2-[[3-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]quinoxalin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]quinoxalin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139959494 |
| Molecular Formula | C30H24FN5O3 |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 2-[[3-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]quinoxalin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nc2ccccc2nc1CN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C30H24FN5O3/c31-19-9-10-22-27(15-19)39-34-28(22)18-11-13-35(14-12-18)16-25-26(33-24-8-4-3-7-23(24)32-25)17-36-29(37)20-5-1-2-6-21(20)30(36)38/h1-10,15,18H,11-14,16-17H2 |
| InChIKey | NECCWVDUBAESHB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|