C22H19FN4O5 — CID 15378694
2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-5-nitroisoindole-1,3-dione (PubChem CID 15378694) has the molecular formula C22H19FN4O5 and a molecular weight of 438.42 g/mol. Its IUPAC name is 2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 15378694 |
| Molecular Formula | C22H19FN4O5 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-5-nitroisoindole-1,3-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C22H19FN4O5/c23-14-1-3-17-19(11-14)32-24-20(17)13-5-7-25(8-6-13)9-10-26-21(28)16-4-2-15(27(30)31)12-18(16)22(26)29/h1-4,11-13H,5-10H2 |
| InChIKey | IEASCCZAONDIKO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 109.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|