C24H24FN3O2 — CID 174371626
2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-3-methylidene-1H-isoindole-1-carbaldehyde (PubChem CID 174371626) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is 2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-3-methylidene-1H-isoindole-1-carbaldehyde.
| Compound Name | 2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-3-methylidene-1H-isoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174371626 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-3-methylidene-1H-isoindole-1-carbaldehyde |
| SMILES | C=C1c2ccccc2C(C=O)N1CCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C24H24FN3O2/c1-16-19-4-2-3-5-20(19)22(15-29)28(16)13-12-27-10-8-17(9-11-27)24-21-7-6-18(25)14-23(21)30-26-24/h2-7,14-15,17,22H,1,8-13H2 |
| InChIKey | VCEZVTLTEXAEGX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|