C31H34FN3O9 — CID 67593315
bis(but-2-enedioic acid);3-[1-(1-ethyl-3,4-dihydro-2H-isoquinolin-1-yl)piperidin-4-yl]-6-fluoro-1,2-benzoxazole (PubChem CID 67593315) has the molecular formula C31H34FN3O9 and a molecular weight of 611.62 g/mol. Its IUPAC name is bis(but-2-enedioic acid);3-[1-(1-ethyl-3,4-dihydro-2H-isoquinolin-1-yl)piperidin-4-yl]-6-fluoro-1,2-benzoxazole.
| Compound Name | bis(but-2-enedioic acid);3-[1-(1-ethyl-3,4-dihydro-2H-isoquinolin-1-yl)piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
|---|---|
| PubChem CID | 67593315 |
| Molecular Formula | C31H34FN3O9 |
| Molecular Weight | 611.62 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | bis(but-2-enedioic acid);3-[1-(1-ethyl-3,4-dihydro-2H-isoquinolin-1-yl)piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
| SMILES | CCC1(N2CCC(c3noc4cc(F)ccc34)CC2)NCCc2ccccc21.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H26FN3O.2C4H4O4/c1-2-23(20-6-4-3-5-16(20)9-12-25-23)27-13-10-17(11-14-27)22-19-8-7-18(24)15-21(19)28-26-22;2*5-3(6)1-2-4(7)8/h3-8,15,17,25H,2,9-14H2,1H3;2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | HHVBUSYIYGZELC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 190.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|