C24H26N2O5 — CID 174292430
(E)-but-2-enedioic acid;3-[1-(2-phenylethyl)piperidin-4-yl]-1,2-benzoxazole (PubChem CID 174292430) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[1-(2-phenylethyl)piperidin-4-yl]-1,2-benzoxazole.
| Compound Name | (E)-but-2-enedioic acid;3-[1-(2-phenylethyl)piperidin-4-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 174292430 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[1-(2-phenylethyl)piperidin-4-yl]-1,2-benzoxazole |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc(CCN2CCC(c3noc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C20H22N2O.C4H4O4/c1-2-6-16(7-3-1)10-13-22-14-11-17(12-15-22)20-18-8-4-5-9-19(18)23-21-20;5-3(6)1-2-4(7)8/h1-9,17H,10-15H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | WLTAMCGIBABHAH-WLHGVMLRSA-N |
| XLogP | 3.96 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|