C12H19NS — CID 102544357
1-butyl-2-thiophen-2-ylpyrrolidine (PubChem CID 102544357) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 1-butyl-2-thiophen-2-ylpyrrolidine.
| Compound Name | 1-butyl-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 102544357 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-butyl-2-thiophen-2-ylpyrrolidine |
| SMILES | CCCCN1CCCC1c1cccs1 |
| InChI | InChI=1S/C12H19NS/c1-2-3-8-13-9-4-6-11(13)12-7-5-10-14-12/h5,7,10-11H,2-4,6,8-9H2,1H3 |
| InChIKey | REFFIMXEEJORBS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |