C12H19NOS — CID 94383964
(2R)-1-(3-methoxypropyl)-2-thiophen-2-ylpyrrolidine (PubChem CID 94383964) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is (2R)-1-(3-methoxypropyl)-2-thiophen-2-ylpyrrolidine.
| Compound Name | (2R)-1-(3-methoxypropyl)-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 94383964 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (2R)-1-(3-methoxypropyl)-2-thiophen-2-ylpyrrolidine |
| SMILES | COCCCN1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C12H19NOS/c1-14-9-4-8-13-7-2-5-11(13)12-6-3-10-15-12/h3,6,10-11H,2,4-5,7-9H2,1H3/t11-/m1/s1 |
| InChIKey | JOLRCWGZWUSXPX-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|