C15H24N2O2S — CID 92503190
(2R)-N-(3-methoxypropyl)-2-thiophen-2-ylazepane-1-carboxamide (PubChem CID 92503190) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is (2R)-N-(3-methoxypropyl)-2-thiophen-2-ylazepane-1-carboxamide.
| Compound Name | (2R)-N-(3-methoxypropyl)-2-thiophen-2-ylazepane-1-carboxamide |
|---|---|
| PubChem CID | 92503190 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (2R)-N-(3-methoxypropyl)-2-thiophen-2-ylazepane-1-carboxamide |
| SMILES | COCCCNC(=O)N1CCCCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C15H24N2O2S/c1-19-11-6-9-16-15(18)17-10-4-2-3-7-13(17)14-8-5-12-20-14/h5,8,12-13H,2-4,6-7,9-11H2,1H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | IPUPORJUPCZWBA-CYBMUJFWSA-N |
| XLogP | 3.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|