C17H25N3O2S — CID 51084945
N-[2-(2-oxoazepan-1-yl)ethyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 51084945) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[2-(2-oxoazepan-1-yl)ethyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | N-[2-(2-oxoazepan-1-yl)ethyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51084945 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[2-(2-oxoazepan-1-yl)ethyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | O=C1CCCCCN1CCNC(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C17H25N3O2S/c21-16-8-2-1-3-10-19(16)12-9-18-17(22)20-11-4-6-14(20)15-7-5-13-23-15/h5,7,13-14H,1-4,6,8-12H2,(H,18,22) |
| InChIKey | FIHRUEJRYDGBLQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |