C15H18N2O3S — CID 94799365
1-[3-oxo-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propyl]pyrrolidine-2,5-dione (PubChem CID 94799365) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-[3-oxo-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-oxo-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 94799365 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[3-oxo-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCC(=O)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C15H18N2O3S/c18-13-5-6-14(19)17(13)9-7-15(20)16-8-1-3-11(16)12-4-2-10-21-12/h2,4,10-11H,1,3,5-9H2/t11-/m0/s1 |
| InChIKey | CUTXXHLOZNFHPX-NSHDSACASA-N |
| XLogP | 1.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|