C20H19BrN2O3S — CID 55377124
5-bromo-2-[4-oxo-4-(2-thiophen-2-ylpyrrolidin-1-yl)butyl]isoindole-1,3-dione (PubChem CID 55377124) has the molecular formula C20H19BrN2O3S and a molecular weight of 447.35 g/mol. Its IUPAC name is 5-bromo-2-[4-oxo-4-(2-thiophen-2-ylpyrrolidin-1-yl)butyl]isoindole-1,3-dione.
| Compound Name | 5-bromo-2-[4-oxo-4-(2-thiophen-2-ylpyrrolidin-1-yl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55377124 |
| Molecular Formula | C20H19BrN2O3S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 5-bromo-2-[4-oxo-4-(2-thiophen-2-ylpyrrolidin-1-yl)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(Br)cc2C(=O)N1CCCC(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C20H19BrN2O3S/c21-13-7-8-14-15(12-13)20(26)23(19(14)25)10-2-6-18(24)22-9-1-4-16(22)17-5-3-11-27-17/h3,5,7-8,11-12,16H,1-2,4,6,9-10H2 |
| InChIKey | QHUFNARBQNGKSZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|