C16H25N3O2S — CID 94871156
2-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone (PubChem CID 94871156) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 94871156 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(CCO)CC1)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C16H25N3O2S/c20-11-10-17-6-8-18(9-7-17)13-16(21)19-5-1-3-14(19)15-4-2-12-22-15/h2,4,12,14,20H,1,3,5-11,13H2/t14-/m0/s1 |
| InChIKey | OSPFRWHHLDXPLM-AWEZNQCLSA-N |
| XLogP | 1.02 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |