C15H22N2O2S — CID 124737947
2-[(2R)-2-methylmorpholin-4-yl]-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone (PubChem CID 124737947) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[(2R)-2-methylmorpholin-4-yl]-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-[(2R)-2-methylmorpholin-4-yl]-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124737947 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[(2R)-2-methylmorpholin-4-yl]-1-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]ethanone |
| SMILES | C[C@@H]1CN(CC(=O)N2CCC[C@H]2c2cccs2)CCO1 |
| InChI | InChI=1S/C15H22N2O2S/c1-12-10-16(7-8-19-12)11-15(18)17-6-2-4-13(17)14-5-3-9-20-14/h3,5,9,12-13H,2,4,6-8,10-11H2,1H3/t12-,13+/m1/s1 |
| InChIKey | QKRUOMDTNNSKTL-OLZOCXBDSA-N |
| XLogP | 2.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |