C19H24N4OS — CID 51199552
2-(4-pyridin-2-ylpiperazin-1-yl)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 51199552) has the molecular formula C19H24N4OS and a molecular weight of 356.49 g/mol. Its IUPAC name is 2-(4-pyridin-2-ylpiperazin-1-yl)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(4-pyridin-2-ylpiperazin-1-yl)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 51199552 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-(4-pyridin-2-ylpiperazin-1-yl)-1-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(c2ccccn2)CC1)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C19H24N4OS/c24-19(23-9-3-5-16(23)17-6-4-14-25-17)15-21-10-12-22(13-11-21)18-7-1-2-8-20-18/h1-2,4,6-8,14,16H,3,5,9-13,15H2 |
| InChIKey | BBILXAUMZTZHTM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |