C20H26N4OS — CID 42950439
1-(4-pyridin-2-ylpiperazin-1-yl)-3-(2-thiophen-2-ylpyrrolidin-1-yl)propan-1-one (PubChem CID 42950439) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-(4-pyridin-2-ylpiperazin-1-yl)-3-(2-thiophen-2-ylpyrrolidin-1-yl)propan-1-one.
| Compound Name | 1-(4-pyridin-2-ylpiperazin-1-yl)-3-(2-thiophen-2-ylpyrrolidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 42950439 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-(4-pyridin-2-ylpiperazin-1-yl)-3-(2-thiophen-2-ylpyrrolidin-1-yl)propan-1-one |
| SMILES | O=C(CCN1CCCC1c1cccs1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H26N4OS/c25-20(8-11-22-10-3-5-17(22)18-6-4-16-26-18)24-14-12-23(13-15-24)19-7-1-2-9-21-19/h1-2,4,6-7,9,16-17H,3,5,8,10-15H2 |
| InChIKey | TXZALYAHZCLKKT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |