C20H26N4O3 — CID 7974830
(3aS,7aS)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 7974830) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is (3aS,7aS)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7974830 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (3aS,7aS)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H26N4O3/c25-18(23-13-11-22(12-14-23)17-7-3-4-9-21-17)8-10-24-19(26)15-5-1-2-6-16(15)20(24)27/h3-4,7,9,15-16H,1-2,5-6,8,10-14H2/t15-,16-/m0/s1 |
| InChIKey | YSSVAQKYOPEXTA-HOTGVXAUSA-N |
| XLogP | 1.30 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|