C18H26N4O2 — CID 164640933
(3R)-1-methyl-3-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]azepan-2-one (PubChem CID 164640933) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3R)-1-methyl-3-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]azepan-2-one.
| Compound Name | (3R)-1-methyl-3-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]azepan-2-one |
|---|---|
| PubChem CID | 164640933 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (3R)-1-methyl-3-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]azepan-2-one |
| SMILES | CN1CCCC[C@H](CC(=O)N2CCN(c3ccccn3)CC2)C1=O |
| InChI | InChI=1S/C18H26N4O2/c1-20-9-5-3-6-15(18(20)24)14-17(23)22-12-10-21(11-13-22)16-7-2-4-8-19-16/h2,4,7-8,15H,3,5-6,9-14H2,1H3/t15-/m1/s1 |
| InChIKey | DDIZEUQHHAAXHK-OAHLLOKOSA-N |
| XLogP | 1.38 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |