C21H23N5O3 — CID 124861250
(5R)-3-benzyl-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 124861250) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is (5R)-3-benzyl-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-benzyl-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124861250 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (5R)-3-benzyl-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C(C[C@H]1NC(=O)N(Cc2ccccc2)C1=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H23N5O3/c27-19(25-12-10-24(11-13-25)18-8-4-5-9-22-18)14-17-20(28)26(21(29)23-17)15-16-6-2-1-3-7-16/h1-9,17H,10-15H2,(H,23,29)/t17-/m1/s1 |
| InChIKey | GZMPRHSNJIXZHP-QGZVFWFLSA-N |
| XLogP | 1.24 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|