C23H27N5O4 — CID 75489932
(5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 75489932) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is (5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75489932 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | (5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CCN2C(=O)N[C@@H](CC(=O)N3CCN(c4ccccn4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N5O4/c1-32-18-7-5-17(6-8-18)9-11-28-22(30)19(25-23(28)31)16-21(29)27-14-12-26(13-15-27)20-4-2-3-10-24-20/h2-8,10,19H,9,11-16H2,1H3,(H,25,31)/t19-/m0/s1 |
| InChIKey | AFVYKSYSZAANJG-IBGZPJMESA-N |
| XLogP | 1.29 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|