C17H18N4O4S — CID 99871503
2-[(4R)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 99871503) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-[(4R)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(4R)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 99871503 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[(4R)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc(CCN2C(=O)N[C@H](CC(=O)Nc3nccs3)C2=O)cc1 |
| InChI | InChI=1S/C17H18N4O4S/c1-25-12-4-2-11(3-5-12)6-8-21-15(23)13(19-17(21)24)10-14(22)20-16-18-7-9-26-16/h2-5,7,9,13H,6,8,10H2,1H3,(H,19,24)(H,18,20,22)/t13-/m1/s1 |
| InChIKey | JSUOCLGLWBRPMV-CYBMUJFWSA-N |
| XLogP | 1.64 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|