C12H12N2O2S — CID 770967
2-(4-methoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 770967) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 770967 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C12H12N2O2S/c1-16-10-4-2-9(3-5-10)8-11(15)14-12-13-6-7-17-12/h2-7H,8H2,1H3,(H,13,14,15) |
| InChIKey | SPAPWVUPZKTBMH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |