C23H24N4O4 — CID 71826817
2-[(4S)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylindol-4-yl)acetamide (PubChem CID 71826817) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[(4S)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylindol-4-yl)acetamide.
| Compound Name | 2-[(4S)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylindol-4-yl)acetamide |
|---|---|
| PubChem CID | 71826817 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[(4S)-1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(1-methylindol-4-yl)acetamide |
| SMILES | COc1ccc(CCN2C(=O)N[C@@H](CC(=O)Nc3cccc4c3ccn4C)C2=O)cc1 |
| InChI | InChI=1S/C23H24N4O4/c1-26-12-11-17-18(4-3-5-20(17)26)24-21(28)14-19-22(29)27(23(30)25-19)13-10-15-6-8-16(31-2)9-7-15/h3-9,11-12,19H,10,13-14H2,1-2H3,(H,24,28)(H,25,30)/t19-/m0/s1 |
| InChIKey | IJLASHUFPCAWPE-IBGZPJMESA-N |
| XLogP | 2.68 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|