C22H22N4O3 — CID 99871302
2-[(4R)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(1-methylindol-5-yl)acetamide (PubChem CID 99871302) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(1-methylindol-5-yl)acetamide.
| Compound Name | 2-[(4R)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(1-methylindol-5-yl)acetamide |
|---|---|
| PubChem CID | 99871302 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[(4R)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(1-methylindol-5-yl)acetamide |
| SMILES | Cn1ccc2cc(NC(=O)C[C@H]3NC(=O)N(CCc4ccccc4)C3=O)ccc21 |
| InChI | InChI=1S/C22H22N4O3/c1-25-11-10-16-13-17(7-8-19(16)25)23-20(27)14-18-21(28)26(22(29)24-18)12-9-15-5-3-2-4-6-15/h2-8,10-11,13,18H,9,12,14H2,1H3,(H,23,27)(H,24,29)/t18-/m1/s1 |
| InChIKey | KLCRIFMNNSASSD-GOSISDBHSA-N |
| XLogP | 2.67 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|