C19H22N4O4S — CID 75531875
2-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 75531875) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 75531875 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[1-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-[2-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | COc1ccc(CCN2C(=O)NC(CC(=O)NCCc3nccs3)C2=O)cc1 |
| InChI | InChI=1S/C19H22N4O4S/c1-27-14-4-2-13(3-5-14)7-10-23-18(25)15(22-19(23)26)12-16(24)20-8-6-17-21-9-11-28-17/h2-5,9,11,15H,6-8,10,12H2,1H3,(H,20,24)(H,22,26) |
| InChIKey | XLJDGDWIEOCBHJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|