C25H28N4O5 — CID 75491557
(5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 75491557) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is (5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75491557 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CCN2C(=O)N[C@@H](CC(=O)N3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)C2=O)cc1 |
| InChI | InChI=1S/C25H28N4O5/c1-34-19-7-5-16(6-8-19)9-10-28-24(32)20(26-25(28)33)12-23(31)27-13-17-11-18(15-27)21-3-2-4-22(30)29(21)14-17/h2-8,17-18,20H,9-15H2,1H3,(H,26,33)/t17-,18+,20+/m1/s1 |
| InChIKey | HGWJIRWBIRIVAA-HBFSDRIKSA-N |
| XLogP | 1.36 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|