C24H26N4O4 — CID 99871130
(5R)-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 99871130) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is (5R)-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99871130 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (5R)-5-[2-oxo-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C(C[C@H]1NC(=O)N(CCc2ccccc2)C1=O)N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C24H26N4O4/c29-21-8-4-7-20-18-11-17(14-28(20)21)13-26(15-18)22(30)12-19-23(31)27(24(32)25-19)10-9-16-5-2-1-3-6-16/h1-8,17-19H,9-15H2,(H,25,32)/t17-,18+,19-/m1/s1 |
| InChIKey | NHGHBNKVDAJCBM-CEXWTWQISA-N |
| XLogP | 1.35 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|