C25H26N4O6 — CID 98450485
(5R)-3-(1,3-benzodioxol-5-ylmethyl)-5-[3-oxo-3-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]propyl]imidazolidine-2,4-dione (PubChem CID 98450485) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is (5R)-3-(1,3-benzodioxol-5-ylmethyl)-5-[3-oxo-3-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-(1,3-benzodioxol-5-ylmethyl)-5-[3-oxo-3-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 98450485 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (5R)-3-(1,3-benzodioxol-5-ylmethyl)-5-[3-oxo-3-[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C(CC[C@H]1NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O)N1C[C@@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C25H26N4O6/c30-22(27-10-16-8-17(13-27)19-2-1-3-23(31)28(19)12-16)7-5-18-24(32)29(25(33)26-18)11-15-4-6-20-21(9-15)35-14-34-20/h1-4,6,9,16-18H,5,7-8,10-14H2,(H,26,33)/t16-,17-,18+/m0/s1 |
| InChIKey | IYFLSQKRTNUGJH-OKZBNKHCSA-N |
| XLogP | 1.42 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|