C26H30N5O8- — CID 163181926
3-[(3,4-dimethoxyphenyl)methyl]-5-[3-[5-[hydroxy(oxido)amino]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 163181926) has the molecular formula C26H30N5O8- and a molecular weight of 540.55 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-5-[3-[5-[hydroxy(oxido)amino]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-[3-[5-[hydroxy(oxido)amino]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163181926 |
| Molecular Formula | C26H30N5O8- |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-[3-[5-[hydroxy(oxido)amino]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)NC(CCC(=O)N3CC4CC(C3)c3ccc(N([O-])O)c(=O)n3C4)C2=O)cc1OC |
| InChI | InChI=1S/C26H30N5O8/c1-38-21-7-3-15(10-22(21)39-2)12-30-24(33)18(27-26(30)35)4-8-23(32)28-11-16-9-17(14-28)19-5-6-20(31(36)37)25(34)29(19)13-16/h3,5-7,10,16-18,36H,4,8-9,11-14H2,1-2H3,(H,27,35)/q-1 |
| InChIKey | SFBPWRZRDNUTRC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 156.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|