C25H32N4O6 — CID 125430062
(5S)-3-[(3,4-dimethoxyphenyl)methyl]-5-[2-oxo-2-[(1S,2S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 125430062) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is (5S)-3-[(3,4-dimethoxyphenyl)methyl]-5-[2-oxo-2-[(1S,2S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(3,4-dimethoxyphenyl)methyl]-5-[2-oxo-2-[(1S,2S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 125430062 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (5S)-3-[(3,4-dimethoxyphenyl)methyl]-5-[2-oxo-2-[(1S,2S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)N[C@@H](CC(=O)N3C[C@H]4C[C@@H](C3)[C@@H]3CCCC(=O)N3C4)C2=O)cc1OC |
| InChI | InChI=1S/C25H32N4O6/c1-34-20-7-6-15(9-21(20)35-2)12-29-24(32)18(26-25(29)33)10-23(31)27-11-16-8-17(14-27)19-4-3-5-22(30)28(19)13-16/h6-7,9,16-19H,3-5,8,10-14H2,1-2H3,(H,26,33)/t16-,17+,18+,19+/m1/s1 |
| InChIKey | YJHMXYBODMKTKR-XWSJACJDSA-N |
| XLogP | 1.37 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|