C26H29N5O8 — CID 155486552
3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2-[(1S,9R)-5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 155486552) has the molecular formula C26H29N5O8 and a molecular weight of 539.55 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2-[(1S,9R)-5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2-[(1S,9R)-5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 155486552 |
| Molecular Formula | C26H29N5O8 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2-[(1S,9R)-5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CCN2C(=O)NC(CC(=O)N3C[C@H]4C[C@@H](C3)c3ccc([N+](=O)[O-])c(=O)n3C4)C2=O)cc1OC |
| InChI | InChI=1S/C26H29N5O8/c1-38-21-6-3-15(10-22(21)39-2)7-8-29-24(33)18(27-26(29)35)11-23(32)28-12-16-9-17(14-28)19-4-5-20(31(36)37)25(34)30(19)13-16/h3-6,10,16-18H,7-9,11-14H2,1-2H3,(H,27,35)/t16-,17+,18?/m1/s1 |
| InChIKey | UUHTVOQAQGIMHK-DVKDBIPTSA-N |
| XLogP | 1.27 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|