C24H25N5O7 — CID 171157268
3-[(4-methoxyphenyl)methyl]-5-[2-(5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 171157268) has the molecular formula C24H25N5O7 and a molecular weight of 495.49 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-5-[2-(5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-5-[2-(5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 171157268 |
| Molecular Formula | C24H25N5O7 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-5-[2-(5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)NC(CC(=O)N3CC4CC(C3)c3ccc([N+](=O)[O-])c(=O)n3C4)C2=O)cc1 |
| InChI | InChI=1S/C24H25N5O7/c1-36-17-4-2-14(3-5-17)11-28-22(31)18(25-24(28)33)9-21(30)26-10-15-8-16(13-26)19-6-7-20(29(34)35)23(32)27(19)12-15/h2-7,15-16,18H,8-13H2,1H3,(H,25,33) |
| InChIKey | FGDLAZRXYRGBOX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|