C26H31N5O8 — CID 163181927
(1S,9R)-11-[3-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanoyl]-N-hydroxy-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide (PubChem CID 163181927) has the molecular formula C26H31N5O8 and a molecular weight of 541.56 g/mol. Its IUPAC name is (1S,9R)-11-[3-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanoyl]-N-hydroxy-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide.
| Compound Name | (1S,9R)-11-[3-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanoyl]-N-hydroxy-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide |
|---|---|
| PubChem CID | 163181927 |
| Molecular Formula | C26H31N5O8 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | (1S,9R)-11-[3-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanoyl]-N-hydroxy-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide |
| SMILES | COc1ccc(CN2C(=O)N[C@@H](CCC(=O)N3C[C@H]4C[C@@H](C3)c3ccc([NH+]([O-])O)c(=O)n3C4)C2=O)cc1OC |
| InChI | InChI=1S/C26H31N5O8/c1-38-21-7-3-15(10-22(21)39-2)12-30-24(33)18(27-26(30)35)4-8-23(32)28-11-16-9-17(14-28)19-5-6-20(31(36)37)25(34)29(19)13-16/h3,5-7,10,16-18,31,36H,4,8-9,11-14H2,1-2H3,(H,27,35)/t16-,17+,18+/m1/s1 |
| InChIKey | ZLFAQBSZRDFITQ-SQNIBIBYSA-N |
| XLogP | 0.12 |
| TPSA | 157.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|