C25H27N5O7 — CID 125429058
(5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-[(1S,9R)-5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 125429058) has the molecular formula C25H27N5O7 and a molecular weight of 509.52 g/mol. Its IUPAC name is (5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-[(1S,9R)-5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-[(1S,9R)-5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 125429058 |
| Molecular Formula | C25H27N5O7 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (5S)-3-[2-(4-methoxyphenyl)ethyl]-5-[2-[(1S,9R)-5-nitro-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CCN2C(=O)N[C@@H](CC(=O)N3C[C@H]4C[C@@H](C3)c3ccc([N+](=O)[O-])c(=O)n3C4)C2=O)cc1 |
| InChI | InChI=1S/C25H27N5O7/c1-37-18-4-2-15(3-5-18)8-9-28-23(32)19(26-25(28)34)11-22(31)27-12-16-10-17(14-27)20-6-7-21(30(35)36)24(33)29(20)13-16/h2-7,16-17,19H,8-14H2,1H3,(H,26,34)/t16-,17+,19+/m1/s1 |
| InChIKey | JHFBOLWZWNTABW-AOIWGVFYSA-N |
| XLogP | 1.26 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|