C18H23N3O6 — CID 75532001
3-[(3,4-dimethoxyphenyl)methyl]-5-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione (PubChem CID 75532001) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-5-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75532001 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)NC(CC(=O)N3CCOCC3)C2=O)cc1OC |
| InChI | InChI=1S/C18H23N3O6/c1-25-14-4-3-12(9-15(14)26-2)11-21-17(23)13(19-18(21)24)10-16(22)20-5-7-27-8-6-20/h3-4,9,13H,5-8,10-11H2,1-2H3,(H,19,24) |
| InChIKey | XEODYLQHAOBHIR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|