C21H29N3O6 — CID 124906590
3-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(oxan-4-ylmethyl)propanamide (PubChem CID 124906590) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is 3-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(oxan-4-ylmethyl)propanamide.
| Compound Name | 3-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(oxan-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 124906590 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 3-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(oxan-4-ylmethyl)propanamide |
| SMILES | COc1ccc(CN2C(=O)N[C@H](CCC(=O)NCC3CCOCC3)C2=O)cc1OC |
| InChI | InChI=1S/C21H29N3O6/c1-28-17-5-3-15(11-18(17)29-2)13-24-20(26)16(23-21(24)27)4-6-19(25)22-12-14-7-9-30-10-8-14/h3,5,11,14,16H,4,6-10,12-13H2,1-2H3,(H,22,25)(H,23,27)/t16-/m1/s1 |
| InChIKey | PTNSWONUITZOHD-MRXNPFEDSA-N |
| XLogP | 1.45 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|