C20H28N4O5 — CID 75489147
3-[(4S)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 75489147) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is 3-[(4S)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | 3-[(4S)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 75489147 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-[(4S)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | COc1ccc(CN2C(=O)N[C@@H](CCC(=O)NCCN3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C20H28N4O5/c1-28-16-4-2-15(3-5-16)14-24-19(26)17(22-20(24)27)6-7-18(25)21-8-9-23-10-12-29-13-11-23/h2-5,17H,6-14H2,1H3,(H,21,25)(H,22,27)/t17-/m0/s1 |
| InChIKey | XKNRHCOWHHMLTI-KRWDZBQOSA-N |
| XLogP | 0.34 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|