C20H22N4O4 — CID 51829659
3-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 51829659) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 3-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 51829659 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | COc1ccc(CN2C(=O)N[C@H](CCC(=O)NCc3ccncc3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-28-16-4-2-15(3-5-16)13-24-19(26)17(23-20(24)27)6-7-18(25)22-12-14-8-10-21-11-9-14/h2-5,8-11,17H,6-7,12-13H2,1H3,(H,22,25)(H,23,27)/t17-/m1/s1 |
| InChIKey | QJDUGLYGZOFSOI-QGZVFWFLSA-N |
| XLogP | 1.61 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|