C19H26N4O5 — CID 99870686
2-[(4R)-1-[(2-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 99870686) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[(4R)-1-[(2-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[(4R)-1-[(2-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 99870686 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[(4R)-1-[(2-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | COc1ccccc1CN1C(=O)N[C@H](CC(=O)NCCN2CCOCC2)C1=O |
| InChI | InChI=1S/C19H26N4O5/c1-27-16-5-3-2-4-14(16)13-23-18(25)15(21-19(23)26)12-17(24)20-6-7-22-8-10-28-11-9-22/h2-5,15H,6-13H2,1H3,(H,20,24)(H,21,26)/t15-/m1/s1 |
| InChIKey | OQJGVNNTTADPPK-OAHLLOKOSA-N |
| XLogP | -0.05 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|