C19H22N4O5S — CID 99870995
3-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 99870995) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is 3-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 99870995 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1ccc(CN2C(=O)N[C@H](CCC(=O)Nc3nc(C)cs3)C2=O)cc1OC |
| InChI | InChI=1S/C19H22N4O5S/c1-11-10-29-18(20-11)22-16(24)7-5-13-17(25)23(19(26)21-13)9-12-4-6-14(27-2)15(8-12)28-3/h4,6,8,10,13H,5,7,9H2,1-3H3,(H,21,26)(H,20,22,24)/t13-/m1/s1 |
| InChIKey | HSQMNYYDVJKIBN-CYBMUJFWSA-N |
| XLogP | 2.31 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|